BDBM207984 3,5-Di(4-chlorobenzyl)-4-(6-chloro-1H-indol-3-yl)-5-hydroxy-1,5-dihydro-2H-furan-2-one (2a)
SMILES OC1(Cc2ccc(Cl)cc2)OC(=O)C(Cc2ccc(Cl)cc2)=C1c1c[nH]c2cc(Cl)ccc12
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 207984
Affinity DataKd: 3.10E+3nMpH: 7.4 T: 2°CAssay Description:MST (NanoTemper Technologies GmbH) was used to determine the binding affinities between Mdm2 (residues 1−118 T47W; 500 nM) and inhibitors. T47W...More data for this Ligand-Target Pair